C16H23ClF3IN4 — CID 111174273
2-[(2-chlorophenyl)methyl]-1-ethyl-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine;hydroiodide (PubChem CID 111174273) has the molecular formula C16H23ClF3IN4 and a molecular weight of 490.74 g/mol. Its IUPAC name is 2-[(2-chlorophenyl)methyl]-1-ethyl-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine;hydroiodide.
| Compound Name | 2-[(2-chlorophenyl)methyl]-1-ethyl-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111174273 |
| Molecular Formula | C16H23ClF3IN4 |
| Molecular Weight | 490.74 g/mol |
| Exact Mass | 490.06 |
| IUPAC Name | 2-[(2-chlorophenyl)methyl]-1-ethyl-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccccc1Cl)NC1CCN(CC(F)(F)F)C1.I |
| InChI | InChI=1S/C16H22ClF3N4.HI/c1-2-21-15(22-9-12-5-3-4-6-14(12)17)23-13-7-8-24(10-13)11-16(18,19)20;/h3-6,13H,2,7-11H2,1H3,(H2,21,22,23);1H |
| InChIKey | HQFZMGGIVUWMAX-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.74 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|