C17H27F3IN5O — CID 111915036
2-[(2-ethoxy-3-pyridinyl)methyl]-1-ethyl-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine;hydroiodide (PubChem CID 111915036) has the molecular formula C17H27F3IN5O and a molecular weight of 501.34 g/mol. Its IUPAC name is 2-[(2-ethoxy-3-pyridinyl)methyl]-1-ethyl-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine;hydroiodide.
| Compound Name | 2-[(2-ethoxy-3-pyridinyl)methyl]-1-ethyl-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111915036 |
| Molecular Formula | C17H27F3IN5O |
| Molecular Weight | 501.34 g/mol |
| Exact Mass | 501.12 |
| IUPAC Name | 2-[(2-ethoxy-3-pyridinyl)methyl]-1-ethyl-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccnc1OCC)NC1CCN(CC(F)(F)F)C1.I |
| InChI | InChI=1S/C17H26F3N5O.HI/c1-3-21-16(23-10-13-6-5-8-22-15(13)26-4-2)24-14-7-9-25(11-14)12-17(18,19)20;/h5-6,8,14H,3-4,7,9-12H2,1-2H3,(H2,21,23,24);1H |
| InChIKey | ASVGUTWRTUWEIB-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 61.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.34 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|