C17H24F4N4 — CID 111361585
1-ethyl-2-[2-(2-fluorophenyl)ethyl]-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine (PubChem CID 111361585) has the molecular formula C17H24F4N4 and a molecular weight of 360.40 g/mol. Its IUPAC name is 1-ethyl-2-[2-(2-fluorophenyl)ethyl]-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine.
| Compound Name | 1-ethyl-2-[2-(2-fluorophenyl)ethyl]-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine |
|---|---|
| PubChem CID | 111361585 |
| Molecular Formula | C17H24F4N4 |
| Molecular Weight | 360.40 g/mol |
| Exact Mass | 360.19 |
| IUPAC Name | 1-ethyl-2-[2-(2-fluorophenyl)ethyl]-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine |
| SMILES | CCN/C(=N\CCc1ccccc1F)NC1CCN(CC(F)(F)F)C1 |
| InChI | InChI=1S/C17H24F4N4/c1-2-22-16(23-9-7-13-5-3-4-6-15(13)18)24-14-8-10-25(11-14)12-17(19,20)21/h3-6,14H,2,7-12H2,1H3,(H2,22,23,24) |
| InChIKey | AZOXAADUGZHWSR-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.40 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|