C20H30F4IN5 — CID 111149259
N-ethyl-4-(2-fluorophenyl)-N'-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]piperazine-1-carboximidamide;hydroiodide (PubChem CID 111149259) has the molecular formula C20H30F4IN5 and a molecular weight of 543.39 g/mol. Its IUPAC name is N-ethyl-4-(2-fluorophenyl)-N'-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]piperazine-1-carboximidamide;hydroiodide.
| Compound Name | N-ethyl-4-(2-fluorophenyl)-N'-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111149259 |
| Molecular Formula | C20H30F4IN5 |
| Molecular Weight | 543.39 g/mol |
| Exact Mass | 543.15 |
| IUPAC Name | N-ethyl-4-(2-fluorophenyl)-N'-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]piperazine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CC1CCN(CC(F)(F)F)C1)N1CCN(c2ccccc2F)CC1.I |
| InChI | InChI=1S/C20H29F4N5.HI/c1-2-25-19(26-13-16-7-8-27(14-16)15-20(22,23)24)29-11-9-28(10-12-29)18-6-4-3-5-17(18)21;/h3-6,16H,2,7-15H2,1H3,(H,25,26);1H |
| InChIKey | UYUZTYADKJYZNR-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 34.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.39 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|