C20H29F3N4 — CID 111724369
N-ethyl-3-phenyl-N'-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]pyrrolidine-1-carboximidamide (PubChem CID 111724369) has the molecular formula C20H29F3N4 and a molecular weight of 382.47 g/mol. Its IUPAC name is N-ethyl-3-phenyl-N'-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]pyrrolidine-1-carboximidamide.
| Compound Name | N-ethyl-3-phenyl-N'-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111724369 |
| Molecular Formula | C20H29F3N4 |
| Molecular Weight | 382.47 g/mol |
| Exact Mass | 382.23 |
| IUPAC Name | N-ethyl-3-phenyl-N'-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]pyrrolidine-1-carboximidamide |
| SMILES | CCN/C(=N\CC1CCN(CC(F)(F)F)C1)N1CCC(c2ccccc2)C1 |
| InChI | InChI=1S/C20H29F3N4/c1-2-24-19(25-12-16-8-10-26(13-16)15-20(21,22)23)27-11-9-18(14-27)17-6-4-3-5-7-17/h3-7,16,18H,2,8-15H2,1H3,(H,24,25) |
| InChIKey | AJUFWGDATZCVAC-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.47 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|