C19H28F3IN4 — CID 111065449
N-phenyl-N'-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]piperidine-1-carboximidamide;hydroiodide (PubChem CID 111065449) has the molecular formula C19H28F3IN4 and a molecular weight of 496.36 g/mol. Its IUPAC name is N-phenyl-N'-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]piperidine-1-carboximidamide;hydroiodide.
| Compound Name | N-phenyl-N'-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]piperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111065449 |
| Molecular Formula | C19H28F3IN4 |
| Molecular Weight | 496.36 g/mol |
| Exact Mass | 496.13 |
| IUPAC Name | N-phenyl-N'-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]piperidine-1-carboximidamide;hydroiodide |
| SMILES | FC(F)(F)CN1CCC(C/N=C(/Nc2ccccc2)N2CCCCC2)C1.I |
| InChI | InChI=1S/C19H27F3N4.HI/c20-19(21,22)15-25-12-9-16(14-25)13-23-18(26-10-5-2-6-11-26)24-17-7-3-1-4-8-17;/h1,3-4,7-8,16H,2,5-6,9-15H2,(H,23,24);1H |
| InChIKey | UOEQSAWYPYRKKO-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.36 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|