C15H21F3N4 — CID 111065398
1-(3-methylphenyl)-2-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]guanidine (PubChem CID 111065398) has the molecular formula C15H21F3N4 and a molecular weight of 314.36 g/mol. Its IUPAC name is 1-(3-methylphenyl)-2-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]guanidine.
| Compound Name | 1-(3-methylphenyl)-2-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]guanidine |
|---|---|
| PubChem CID | 111065398 |
| Molecular Formula | C15H21F3N4 |
| Molecular Weight | 314.36 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | 1-(3-methylphenyl)-2-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]guanidine |
| SMILES | Cc1cccc(N/C(N)=N/CC2CCN(CC(F)(F)F)C2)c1 |
| InChI | InChI=1S/C15H21F3N4/c1-11-3-2-4-13(7-11)21-14(19)20-8-12-5-6-22(9-12)10-15(16,17)18/h2-4,7,12H,5-6,8-10H2,1H3,(H3,19,20,21) |
| InChIKey | COHCNHWOVVFSPJ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.36 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|