C16H24F3IN4 — CID 111065411
1-(3,5-dimethylphenyl)-2-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]guanidine;hydroiodide (PubChem CID 111065411) has the molecular formula C16H24F3IN4 and a molecular weight of 456.29 g/mol. Its IUPAC name is 1-(3,5-dimethylphenyl)-2-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]guanidine;hydroiodide.
| Compound Name | 1-(3,5-dimethylphenyl)-2-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111065411 |
| Molecular Formula | C16H24F3IN4 |
| Molecular Weight | 456.29 g/mol |
| Exact Mass | 456.10 |
| IUPAC Name | 1-(3,5-dimethylphenyl)-2-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]guanidine;hydroiodide |
| SMILES | Cc1cc(C)cc(N/C(N)=N/CC2CCN(CC(F)(F)F)C2)c1.I |
| InChI | InChI=1S/C16H23F3N4.HI/c1-11-5-12(2)7-14(6-11)22-15(20)21-8-13-3-4-23(9-13)10-16(17,18)19;/h5-7,13H,3-4,8-10H2,1-2H3,(H3,20,21,22);1H |
| InChIKey | HQFANYAZKJGTCB-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.29 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|