C18H28F3IN4O2 — CID 111065423
1-[2-(3,4-dimethoxyphenyl)ethyl]-2-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]guanidine;hydroiodide (PubChem CID 111065423) has the molecular formula C18H28F3IN4O2 and a molecular weight of 516.35 g/mol. Its IUPAC name is 1-[2-(3,4-dimethoxyphenyl)ethyl]-2-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]-2-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111065423 |
| Molecular Formula | C18H28F3IN4O2 |
| Molecular Weight | 516.35 g/mol |
| Exact Mass | 516.12 |
| IUPAC Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]-2-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]guanidine;hydroiodide |
| SMILES | COc1ccc(CCN/C(N)=N/CC2CCN(CC(F)(F)F)C2)cc1OC.I |
| InChI | InChI=1S/C18H27F3N4O2.HI/c1-26-15-4-3-13(9-16(15)27-2)5-7-23-17(22)24-10-14-6-8-25(11-14)12-18(19,20)21;/h3-4,9,14H,5-8,10-12H2,1-2H3,(H3,22,23,24);1H |
| InChIKey | NUUKXMLOQUHIDQ-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 72.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.35 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|