C22H28F2N4O2 — CID 111084683
2-[[1-(3,4-difluorophenyl)pyrrolidin-3-yl]methyl]-1-[2-(3,4-dimethoxyphenyl)ethyl]guanidine (PubChem CID 111084683) has the molecular formula C22H28F2N4O2 and a molecular weight of 418.49 g/mol. Its IUPAC name is 2-[[1-(3,4-difluorophenyl)pyrrolidin-3-yl]methyl]-1-[2-(3,4-dimethoxyphenyl)ethyl]guanidine.
| Compound Name | 2-[[1-(3,4-difluorophenyl)pyrrolidin-3-yl]methyl]-1-[2-(3,4-dimethoxyphenyl)ethyl]guanidine |
|---|---|
| PubChem CID | 111084683 |
| Molecular Formula | C22H28F2N4O2 |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.22 |
| IUPAC Name | 2-[[1-(3,4-difluorophenyl)pyrrolidin-3-yl]methyl]-1-[2-(3,4-dimethoxyphenyl)ethyl]guanidine |
| SMILES | COc1ccc(CCN/C(N)=N/CC2CCN(c3ccc(F)c(F)c3)C2)cc1OC |
| InChI | InChI=1S/C22H28F2N4O2/c1-29-20-6-3-15(11-21(20)30-2)7-9-26-22(25)27-13-16-8-10-28(14-16)17-4-5-18(23)19(24)12-17/h3-6,11-12,16H,7-10,13-14H2,1-2H3,(H3,25,26,27) |
| InChIKey | IBCNKLWSTWSKKO-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 72.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|