C20H24F2N4 — CID 111084695
2-[[1-(3,4-difluorophenyl)pyrrolidin-3-yl]methyl]-1-(3-ethylphenyl)guanidine (PubChem CID 111084695) has the molecular formula C20H24F2N4 and a molecular weight of 358.44 g/mol. Its IUPAC name is 2-[[1-(3,4-difluorophenyl)pyrrolidin-3-yl]methyl]-1-(3-ethylphenyl)guanidine.
| Compound Name | 2-[[1-(3,4-difluorophenyl)pyrrolidin-3-yl]methyl]-1-(3-ethylphenyl)guanidine |
|---|---|
| PubChem CID | 111084695 |
| Molecular Formula | C20H24F2N4 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.20 |
| IUPAC Name | 2-[[1-(3,4-difluorophenyl)pyrrolidin-3-yl]methyl]-1-(3-ethylphenyl)guanidine |
| SMILES | CCc1cccc(N/C(N)=N/CC2CCN(c3ccc(F)c(F)c3)C2)c1 |
| InChI | InChI=1S/C20H24F2N4/c1-2-14-4-3-5-16(10-14)25-20(23)24-12-15-8-9-26(13-15)17-6-7-18(21)19(22)11-17/h3-7,10-11,15H,2,8-9,12-13H2,1H3,(H3,23,24,25) |
| InChIKey | DFDGXDJUWOIOIT-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|