C22H28F2N4 — CID 110948268
2-[[1-(3,4-difluorophenyl)pyrrolidin-3-yl]methyl]-1-ethyl-3-(1-phenylethyl)guanidine (PubChem CID 110948268) has the molecular formula C22H28F2N4 and a molecular weight of 386.49 g/mol. Its IUPAC name is 2-[[1-(3,4-difluorophenyl)pyrrolidin-3-yl]methyl]-1-ethyl-3-(1-phenylethyl)guanidine.
| Compound Name | 2-[[1-(3,4-difluorophenyl)pyrrolidin-3-yl]methyl]-1-ethyl-3-(1-phenylethyl)guanidine |
|---|---|
| PubChem CID | 110948268 |
| Molecular Formula | C22H28F2N4 |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.23 |
| IUPAC Name | 2-[[1-(3,4-difluorophenyl)pyrrolidin-3-yl]methyl]-1-ethyl-3-(1-phenylethyl)guanidine |
| SMILES | CCN/C(=N\CC1CCN(c2ccc(F)c(F)c2)C1)NC(C)c1ccccc1 |
| InChI | InChI=1S/C22H28F2N4/c1-3-25-22(27-16(2)18-7-5-4-6-8-18)26-14-17-11-12-28(15-17)19-9-10-20(23)21(24)13-19/h4-10,13,16-17H,3,11-12,14-15H2,1-2H3,(H2,25,26,27) |
| InChIKey | NDBNTBDAQUQANM-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|