C20H26N8 — CID 119934071
1-(3-ethylphenyl)-2-[[1-([1,2,4]triazolo[4,3-a]pyrazin-8-yl)piperidin-3-yl]methyl]guanidine (PubChem CID 119934071) has the molecular formula C20H26N8 and a molecular weight of 378.48 g/mol. Its IUPAC name is 1-(3-ethylphenyl)-2-[[1-([1,2,4]triazolo[4,3-a]pyrazin-8-yl)piperidin-3-yl]methyl]guanidine.
| Compound Name | 1-(3-ethylphenyl)-2-[[1-([1,2,4]triazolo[4,3-a]pyrazin-8-yl)piperidin-3-yl]methyl]guanidine |
|---|---|
| PubChem CID | 119934071 |
| Molecular Formula | C20H26N8 |
| Molecular Weight | 378.48 g/mol |
| Exact Mass | 378.23 |
| IUPAC Name | 1-(3-ethylphenyl)-2-[[1-([1,2,4]triazolo[4,3-a]pyrazin-8-yl)piperidin-3-yl]methyl]guanidine |
| SMILES | CCc1cccc(N/C(N)=N/CC2CCCN(c3nccn4cnnc34)C2)c1 |
| InChI | InChI=1S/C20H26N8/c1-2-15-5-3-7-17(11-15)25-20(21)23-12-16-6-4-9-27(13-16)18-19-26-24-14-28(19)10-8-22-18/h3,5,7-8,10-11,14,16H,2,4,6,9,12-13H2,1H3,(H3,21,23,25) |
| InChIKey | MIXHPFRDILSULP-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 96.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.48 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|