C11H14ClN5 — CID 114682577
8-(4-chloro-3-methylpiperidin-1-yl)-[1,2,4]triazolo[4,3-a]pyrazine (PubChem CID 114682577) has the molecular formula C11H14ClN5 and a molecular weight of 251.72 g/mol. Its IUPAC name is 8-(4-chloro-3-methylpiperidin-1-yl)-[1,2,4]triazolo[4,3-a]pyrazine.
| Compound Name | 8-(4-chloro-3-methylpiperidin-1-yl)-[1,2,4]triazolo[4,3-a]pyrazine |
|---|---|
| PubChem CID | 114682577 |
| Molecular Formula | C11H14ClN5 |
| Molecular Weight | 251.72 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | 8-(4-chloro-3-methylpiperidin-1-yl)-[1,2,4]triazolo[4,3-a]pyrazine |
| SMILES | CC1CN(c2nccn3cnnc23)CCC1Cl |
| InChI | InChI=1S/C11H14ClN5/c1-8-6-16(4-2-9(8)12)10-11-15-14-7-17(11)5-3-13-10/h3,5,7-9H,2,4,6H2,1H3 |
| InChIKey | WYTGVTYYMQPTNY-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 46.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.72 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|