C15H23IN8 — CID 119934052
1-cyclopropyl-2-[[1-([1,2,4]triazolo[4,3-a]pyrazin-8-yl)piperidin-3-yl]methyl]guanidine;hydroiodide (PubChem CID 119934052) has the molecular formula C15H23IN8 and a molecular weight of 442.31 g/mol. Its IUPAC name is 1-cyclopropyl-2-[[1-([1,2,4]triazolo[4,3-a]pyrazin-8-yl)piperidin-3-yl]methyl]guanidine;hydroiodide.
| Compound Name | 1-cyclopropyl-2-[[1-([1,2,4]triazolo[4,3-a]pyrazin-8-yl)piperidin-3-yl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 119934052 |
| Molecular Formula | C15H23IN8 |
| Molecular Weight | 442.31 g/mol |
| Exact Mass | 442.11 |
| IUPAC Name | 1-cyclopropyl-2-[[1-([1,2,4]triazolo[4,3-a]pyrazin-8-yl)piperidin-3-yl]methyl]guanidine;hydroiodide |
| SMILES | I.N/C(=N\CC1CCCN(c2nccn3cnnc23)C1)NC1CC1 |
| InChI | InChI=1S/C15H22N8.HI/c16-15(20-12-3-4-12)18-8-11-2-1-6-22(9-11)13-14-21-19-10-23(14)7-5-17-13;/h5,7,10-12H,1-4,6,8-9H2,(H3,16,18,20);1H |
| InChIKey | NWKWPZWMPDQIJR-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 96.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.31 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|