C22H36N4 — CID 111144540
N-ethyl-3-methyl-N'-[[1-(2-phenylethyl)pyrrolidin-3-yl]methyl]piperidine-1-carboximidamide (PubChem CID 111144540) has the molecular formula C22H36N4 and a molecular weight of 356.56 g/mol. Its IUPAC name is N-ethyl-3-methyl-N'-[[1-(2-phenylethyl)pyrrolidin-3-yl]methyl]piperidine-1-carboximidamide.
| Compound Name | N-ethyl-3-methyl-N'-[[1-(2-phenylethyl)pyrrolidin-3-yl]methyl]piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 111144540 |
| Molecular Formula | C22H36N4 |
| Molecular Weight | 356.56 g/mol |
| Exact Mass | 356.29 |
| IUPAC Name | N-ethyl-3-methyl-N'-[[1-(2-phenylethyl)pyrrolidin-3-yl]methyl]piperidine-1-carboximidamide |
| SMILES | CCN/C(=N\CC1CCN(CCc2ccccc2)C1)N1CCCC(C)C1 |
| InChI | InChI=1S/C22H36N4/c1-3-23-22(26-13-7-8-19(2)17-26)24-16-21-12-15-25(18-21)14-11-20-9-5-4-6-10-20/h4-6,9-10,19,21H,3,7-8,11-18H2,1-2H3,(H,23,24) |
| InChIKey | CZQLIJRLQHBVJT-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.56 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|