C23H36N4 — CID 109414811
4-benzylidene-N-ethyl-N'-[(1-propylpyrrolidin-3-yl)methyl]piperidine-1-carboximidamide (PubChem CID 109414811) has the molecular formula C23H36N4 and a molecular weight of 368.57 g/mol. Its IUPAC name is 4-benzylidene-N-ethyl-N'-[(1-propylpyrrolidin-3-yl)methyl]piperidine-1-carboximidamide.
| Compound Name | 4-benzylidene-N-ethyl-N'-[(1-propylpyrrolidin-3-yl)methyl]piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 109414811 |
| Molecular Formula | C23H36N4 |
| Molecular Weight | 368.57 g/mol |
| Exact Mass | 368.29 |
| IUPAC Name | 4-benzylidene-N-ethyl-N'-[(1-propylpyrrolidin-3-yl)methyl]piperidine-1-carboximidamide |
| SMILES | CCCN1CCC(C/N=C(\NCC)N2CCC(=Cc3ccccc3)CC2)C1 |
| InChI | InChI=1S/C23H36N4/c1-3-13-26-14-10-22(19-26)18-25-23(24-4-2)27-15-11-21(12-16-27)17-20-8-6-5-7-9-20/h5-9,17,22H,3-4,10-16,18-19H2,1-2H3,(H,24,25) |
| InChIKey | JQSKTTBUPMMGHN-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.57 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|