C17H27IN4O — CID 111132834
4-(2-methoxyphenyl)-N'-methyl-N-(2-methylcyclopropyl)piperazine-1-carboximidamide;hydroiodide (PubChem CID 111132834) has the molecular formula C17H27IN4O and a molecular weight of 430.33 g/mol. Its IUPAC name is 4-(2-methoxyphenyl)-N'-methyl-N-(2-methylcyclopropyl)piperazine-1-carboximidamide;hydroiodide.
| Compound Name | 4-(2-methoxyphenyl)-N'-methyl-N-(2-methylcyclopropyl)piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111132834 |
| Molecular Formula | C17H27IN4O |
| Molecular Weight | 430.33 g/mol |
| Exact Mass | 430.12 |
| IUPAC Name | 4-(2-methoxyphenyl)-N'-methyl-N-(2-methylcyclopropyl)piperazine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(/NC1CC1C)N1CCN(c2ccccc2OC)CC1.I |
| InChI | InChI=1S/C17H26N4O.HI/c1-13-12-14(13)19-17(18-2)21-10-8-20(9-11-21)15-6-4-5-7-16(15)22-3;/h4-7,13-14H,8-12H2,1-3H3,(H,18,19);1H |
| InChIKey | NRMDQEHLGFGHLC-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 40.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.33 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|