C16H26ClN5O2S — CID 111177346
4-(2-chlorophenyl)-N-[2-(ethylsulfonylamino)ethyl]-N'-methylpiperazine-1-carboximidamide (PubChem CID 111177346) has the molecular formula C16H26ClN5O2S and a molecular weight of 387.94 g/mol. Its IUPAC name is 4-(2-chlorophenyl)-N-[2-(ethylsulfonylamino)ethyl]-N'-methylpiperazine-1-carboximidamide.
| Compound Name | 4-(2-chlorophenyl)-N-[2-(ethylsulfonylamino)ethyl]-N'-methylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111177346 |
| Molecular Formula | C16H26ClN5O2S |
| Molecular Weight | 387.94 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | 4-(2-chlorophenyl)-N-[2-(ethylsulfonylamino)ethyl]-N'-methylpiperazine-1-carboximidamide |
| SMILES | CCS(=O)(=O)NCCN/C(=N\C)N1CCN(c2ccccc2Cl)CC1 |
| InChI | InChI=1S/C16H26ClN5O2S/c1-3-25(23,24)20-9-8-19-16(18-2)22-12-10-21(11-13-22)15-7-5-4-6-14(15)17/h4-7,20H,3,8-13H2,1-2H3,(H,18,19) |
| InChIKey | KWLFYCXYMDWIPY-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.94 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|