C17H26ClIN4O — CID 111177775
4-(2-chlorophenyl)-N'-methyl-N-(oxolan-3-ylmethyl)piperazine-1-carboximidamide;hydroiodide (PubChem CID 111177775) has the molecular formula C17H26ClIN4O and a molecular weight of 464.78 g/mol. Its IUPAC name is 4-(2-chlorophenyl)-N'-methyl-N-(oxolan-3-ylmethyl)piperazine-1-carboximidamide;hydroiodide.
| Compound Name | 4-(2-chlorophenyl)-N'-methyl-N-(oxolan-3-ylmethyl)piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111177775 |
| Molecular Formula | C17H26ClIN4O |
| Molecular Weight | 464.78 g/mol |
| Exact Mass | 464.08 |
| IUPAC Name | 4-(2-chlorophenyl)-N'-methyl-N-(oxolan-3-ylmethyl)piperazine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCC1CCOC1)N1CCN(c2ccccc2Cl)CC1.I |
| InChI | InChI=1S/C17H25ClN4O.HI/c1-19-17(20-12-14-6-11-23-13-14)22-9-7-21(8-10-22)16-5-3-2-4-15(16)18;/h2-5,14H,6-13H2,1H3,(H,19,20);1H |
| InChIKey | CFHSKFCNTVGKIF-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 40.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.78 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|