C17H27IN4O3S — CID 111184817
N-[(1,1-dioxothiolan-3-yl)methyl]-4-(2-hydroxyphenyl)-N'-methylpiperazine-1-carboximidamide;hydroiodide (PubChem CID 111184817) has the molecular formula C17H27IN4O3S and a molecular weight of 494.40 g/mol. Its IUPAC name is N-[(1,1-dioxothiolan-3-yl)methyl]-4-(2-hydroxyphenyl)-N'-methylpiperazine-1-carboximidamide;hydroiodide.
| Compound Name | N-[(1,1-dioxothiolan-3-yl)methyl]-4-(2-hydroxyphenyl)-N'-methylpiperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111184817 |
| Molecular Formula | C17H27IN4O3S |
| Molecular Weight | 494.40 g/mol |
| Exact Mass | 494.08 |
| IUPAC Name | N-[(1,1-dioxothiolan-3-yl)methyl]-4-(2-hydroxyphenyl)-N'-methylpiperazine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCC1CCS(=O)(=O)C1)N1CCN(c2ccccc2O)CC1.I |
| InChI | InChI=1S/C17H26N4O3S.HI/c1-18-17(19-12-14-6-11-25(23,24)13-14)21-9-7-20(8-10-21)15-4-2-3-5-16(15)22;/h2-5,14,22H,6-13H2,1H3,(H,18,19);1H |
| InChIKey | UUGHHVUCFHZXES-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 85.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.40 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|