C19H31IN4O2S — CID 111238576
4-(2,3-dimethylphenyl)-N-[(1,1-dioxothiolan-3-yl)methyl]-N'-methylpiperazine-1-carboximidamide;hydroiodide (PubChem CID 111238576) has the molecular formula C19H31IN4O2S and a molecular weight of 506.45 g/mol. Its IUPAC name is 4-(2,3-dimethylphenyl)-N-[(1,1-dioxothiolan-3-yl)methyl]-N'-methylpiperazine-1-carboximidamide;hydroiodide.
| Compound Name | 4-(2,3-dimethylphenyl)-N-[(1,1-dioxothiolan-3-yl)methyl]-N'-methylpiperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111238576 |
| Molecular Formula | C19H31IN4O2S |
| Molecular Weight | 506.45 g/mol |
| Exact Mass | 506.12 |
| IUPAC Name | 4-(2,3-dimethylphenyl)-N-[(1,1-dioxothiolan-3-yl)methyl]-N'-methylpiperazine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCC1CCS(=O)(=O)C1)N1CCN(c2cccc(C)c2C)CC1.I |
| InChI | InChI=1S/C19H30N4O2S.HI/c1-15-5-4-6-18(16(15)2)22-8-10-23(11-9-22)19(20-3)21-13-17-7-12-26(24,25)14-17;/h4-6,17H,7-14H2,1-3H3,(H,20,21);1H |
| InChIKey | SMIVKUSNERHVBR-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 65.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.45 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|