C18H28N2O2S — CID 155975423
4-[[4-(2,3-dimethylphenyl)piperazin-1-yl]methyl]thiane 1,1-dioxide (PubChem CID 155975423) has the molecular formula C18H28N2O2S and a molecular weight of 336.50 g/mol. Its IUPAC name is 4-[[4-(2,3-dimethylphenyl)piperazin-1-yl]methyl]thiane 1,1-dioxide.
| Compound Name | 4-[[4-(2,3-dimethylphenyl)piperazin-1-yl]methyl]thiane 1,1-dioxide |
|---|---|
| PubChem CID | 155975423 |
| Molecular Formula | C18H28N2O2S |
| Molecular Weight | 336.50 g/mol |
| Exact Mass | 336.19 |
| IUPAC Name | 4-[[4-(2,3-dimethylphenyl)piperazin-1-yl]methyl]thiane 1,1-dioxide |
| SMILES | Cc1cccc(N2CCN(CC3CCS(=O)(=O)CC3)CC2)c1C |
| InChI | InChI=1S/C18H28N2O2S/c1-15-4-3-5-18(16(15)2)20-10-8-19(9-11-20)14-17-6-12-23(21,22)13-7-17/h3-5,17H,6-14H2,1-2H3 |
| InChIKey | PVGCVTSPOIZSDA-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.50 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |