C23H39N5 — CID 111238595
4-(2,3-dimethylphenyl)-N'-methyl-N-[(1-propan-2-ylpiperidin-3-yl)methyl]piperazine-1-carboximidamide (PubChem CID 111238595) has the molecular formula C23H39N5 and a molecular weight of 385.60 g/mol. Its IUPAC name is 4-(2,3-dimethylphenyl)-N'-methyl-N-[(1-propan-2-ylpiperidin-3-yl)methyl]piperazine-1-carboximidamide.
| Compound Name | 4-(2,3-dimethylphenyl)-N'-methyl-N-[(1-propan-2-ylpiperidin-3-yl)methyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111238595 |
| Molecular Formula | C23H39N5 |
| Molecular Weight | 385.60 g/mol |
| Exact Mass | 385.32 |
| IUPAC Name | 4-(2,3-dimethylphenyl)-N'-methyl-N-[(1-propan-2-ylpiperidin-3-yl)methyl]piperazine-1-carboximidamide |
| SMILES | C/N=C(\NCC1CCCN(C(C)C)C1)N1CCN(c2cccc(C)c2C)CC1 |
| InChI | InChI=1S/C23H39N5/c1-18(2)28-11-7-9-21(17-28)16-25-23(24-5)27-14-12-26(13-15-27)22-10-6-8-19(3)20(22)4/h6,8,10,18,21H,7,9,11-17H2,1-5H3,(H,24,25) |
| InChIKey | BEGHTRFJERPYQK-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 34.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.60 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|