C22H38N6O — CID 111133017
4-(2-methoxyphenyl)-N'-methyl-N-[2-methyl-3-(4-methylpiperazin-1-yl)propyl]piperazine-1-carboximidamide (PubChem CID 111133017) has the molecular formula C22H38N6O and a molecular weight of 402.59 g/mol. Its IUPAC name is 4-(2-methoxyphenyl)-N'-methyl-N-[2-methyl-3-(4-methylpiperazin-1-yl)propyl]piperazine-1-carboximidamide.
| Compound Name | 4-(2-methoxyphenyl)-N'-methyl-N-[2-methyl-3-(4-methylpiperazin-1-yl)propyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111133017 |
| Molecular Formula | C22H38N6O |
| Molecular Weight | 402.59 g/mol |
| Exact Mass | 402.31 |
| IUPAC Name | 4-(2-methoxyphenyl)-N'-methyl-N-[2-methyl-3-(4-methylpiperazin-1-yl)propyl]piperazine-1-carboximidamide |
| SMILES | C/N=C(\NCC(C)CN1CCN(C)CC1)N1CCN(c2ccccc2OC)CC1 |
| InChI | InChI=1S/C22H38N6O/c1-19(18-26-11-9-25(3)10-12-26)17-24-22(23-2)28-15-13-27(14-16-28)20-7-5-6-8-21(20)29-4/h5-8,19H,9-18H2,1-4H3,(H,23,24) |
| InChIKey | WCBDYDWLZNHYKA-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 46.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.59 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|