C22H38IN5O2 — CID 111269794
6,7-dimethoxy-N'-methyl-N-[2-methyl-3-(4-methylpiperazin-1-yl)propyl]-3,4-dihydro-1H-isoquinoline-2-carboximidamide;hydroiodide (PubChem CID 111269794) has the molecular formula C22H38IN5O2 and a molecular weight of 531.48 g/mol. Its IUPAC name is 6,7-dimethoxy-N'-methyl-N-[2-methyl-3-(4-methylpiperazin-1-yl)propyl]-3,4-dihydro-1H-isoquinoline-2-carboximidamide;hydroiodide.
| Compound Name | 6,7-dimethoxy-N'-methyl-N-[2-methyl-3-(4-methylpiperazin-1-yl)propyl]-3,4-dihydro-1H-isoquinoline-2-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111269794 |
| Molecular Formula | C22H38IN5O2 |
| Molecular Weight | 531.48 g/mol |
| Exact Mass | 531.21 |
| IUPAC Name | 6,7-dimethoxy-N'-methyl-N-[2-methyl-3-(4-methylpiperazin-1-yl)propyl]-3,4-dihydro-1H-isoquinoline-2-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCC(C)CN1CCN(C)CC1)N1CCc2cc(OC)c(OC)cc2C1.I |
| InChI | InChI=1S/C22H37N5O2.HI/c1-17(15-26-10-8-25(3)9-11-26)14-24-22(23-2)27-7-6-18-12-20(28-4)21(29-5)13-19(18)16-27;/h12-13,17H,6-11,14-16H2,1-5H3,(H,23,24);1H |
| InChIKey | BWMKQAAVSCXEAQ-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.48 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|