C20H24Cl2N4O2 — CID 111167209
N-[2-(2,6-dichlorophenyl)propyl]-4-(furan-2-carbonyl)-N'-methylpiperazine-1-carboximidamide (PubChem CID 111167209) has the molecular formula C20H24Cl2N4O2 and a molecular weight of 423.34 g/mol. Its IUPAC name is N-[2-(2,6-dichlorophenyl)propyl]-4-(furan-2-carbonyl)-N'-methylpiperazine-1-carboximidamide.
| Compound Name | N-[2-(2,6-dichlorophenyl)propyl]-4-(furan-2-carbonyl)-N'-methylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111167209 |
| Molecular Formula | C20H24Cl2N4O2 |
| Molecular Weight | 423.34 g/mol |
| Exact Mass | 422.13 |
| IUPAC Name | N-[2-(2,6-dichlorophenyl)propyl]-4-(furan-2-carbonyl)-N'-methylpiperazine-1-carboximidamide |
| SMILES | C/N=C(\NCC(C)c1c(Cl)cccc1Cl)N1CCN(C(=O)c2ccco2)CC1 |
| InChI | InChI=1S/C20H24Cl2N4O2/c1-14(18-15(21)5-3-6-16(18)22)13-24-20(23-2)26-10-8-25(9-11-26)19(27)17-7-4-12-28-17/h3-7,12,14H,8-11,13H2,1-2H3,(H,23,24) |
| InChIKey | AHOGIXRATCCKHP-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 61.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.34 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|