C24H34N6O2 — CID 111167001
4-(furan-2-carbonyl)-N'-methyl-N-[2-(4-phenylpiperazin-1-yl)propyl]piperazine-1-carboximidamide (PubChem CID 111167001) has the molecular formula C24H34N6O2 and a molecular weight of 438.58 g/mol. Its IUPAC name is 4-(furan-2-carbonyl)-N'-methyl-N-[2-(4-phenylpiperazin-1-yl)propyl]piperazine-1-carboximidamide.
| Compound Name | 4-(furan-2-carbonyl)-N'-methyl-N-[2-(4-phenylpiperazin-1-yl)propyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111167001 |
| Molecular Formula | C24H34N6O2 |
| Molecular Weight | 438.58 g/mol |
| Exact Mass | 438.27 |
| IUPAC Name | 4-(furan-2-carbonyl)-N'-methyl-N-[2-(4-phenylpiperazin-1-yl)propyl]piperazine-1-carboximidamide |
| SMILES | C/N=C(\NCC(C)N1CCN(c2ccccc2)CC1)N1CCN(C(=O)c2ccco2)CC1 |
| InChI | InChI=1S/C24H34N6O2/c1-20(27-10-12-28(13-11-27)21-7-4-3-5-8-21)19-26-24(25-2)30-16-14-29(15-17-30)23(31)22-9-6-18-32-22/h3-9,18,20H,10-17,19H2,1-2H3,(H,25,26) |
| InChIKey | BMJKKMJOJGOQEO-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 67.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.58 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|