C17H28IN5O4S — CID 111168602
N-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-4-(furan-2-carbonyl)-N'-methylpiperazine-1-carboximidamide;hydroiodide (PubChem CID 111168602) has the molecular formula C17H28IN5O4S and a molecular weight of 525.41 g/mol. Its IUPAC name is N-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-4-(furan-2-carbonyl)-N'-methylpiperazine-1-carboximidamide;hydroiodide.
| Compound Name | N-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-4-(furan-2-carbonyl)-N'-methylpiperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111168602 |
| Molecular Formula | C17H28IN5O4S |
| Molecular Weight | 525.41 g/mol |
| Exact Mass | 525.09 |
| IUPAC Name | N-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-4-(furan-2-carbonyl)-N'-methylpiperazine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCCN1CCS(=O)(=O)CC1)N1CCN(C(=O)c2ccco2)CC1.I |
| InChI | InChI=1S/C17H27N5O4S.HI/c1-18-17(19-4-5-20-10-13-27(24,25)14-11-20)22-8-6-21(7-9-22)16(23)15-3-2-12-26-15;/h2-3,12H,4-11,13-14H2,1H3,(H,18,19);1H |
| InChIKey | YVUPZBSEJSJYHU-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 98.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.41 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|