C17H27ClN4O — CID 113105682
N-[2-(3-chlorophenyl)ethyl]-4-[2-(dimethylamino)ethyl]piperazine-1-carboxamide (PubChem CID 113105682) has the molecular formula C17H27ClN4O and a molecular weight of 338.88 g/mol. Its IUPAC name is N-[2-(3-chlorophenyl)ethyl]-4-[2-(dimethylamino)ethyl]piperazine-1-carboxamide.
| Compound Name | N-[2-(3-chlorophenyl)ethyl]-4-[2-(dimethylamino)ethyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 113105682 |
| Molecular Formula | C17H27ClN4O |
| Molecular Weight | 338.88 g/mol |
| Exact Mass | 338.19 |
| IUPAC Name | N-[2-(3-chlorophenyl)ethyl]-4-[2-(dimethylamino)ethyl]piperazine-1-carboxamide |
| SMILES | CN(C)CCN1CCN(C(=O)NCCc2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C17H27ClN4O/c1-20(2)8-9-21-10-12-22(13-11-21)17(23)19-7-6-15-4-3-5-16(18)14-15/h3-5,14H,6-13H2,1-2H3,(H,19,23) |
| InChIKey | BHVQMCHFXGZAPJ-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.88 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |