C22H22F5N3O3 — CID 3831716
N-benzyl-2-[4-[2-(2,3,4,5,6-pentafluorophenoxy)acetyl]-1,4-diazepan-1-yl]acetamide (PubChem CID 3831716) has the molecular formula C22H22F5N3O3 and a molecular weight of 471.43 g/mol. Its IUPAC name is N-benzyl-2-[4-[2-(2,3,4,5,6-pentafluorophenoxy)acetyl]-1,4-diazepan-1-yl]acetamide.
| Compound Name | N-benzyl-2-[4-[2-(2,3,4,5,6-pentafluorophenoxy)acetyl]-1,4-diazepan-1-yl]acetamide |
|---|---|
| PubChem CID | 3831716 |
| Molecular Formula | C22H22F5N3O3 |
| Molecular Weight | 471.43 g/mol |
| Exact Mass | 471.16 |
| IUPAC Name | N-benzyl-2-[4-[2-(2,3,4,5,6-pentafluorophenoxy)acetyl]-1,4-diazepan-1-yl]acetamide |
| SMILES | O=C(CN1CCCN(C(=O)COc2c(F)c(F)c(F)c(F)c2F)CC1)NCc1ccccc1 |
| InChI | InChI=1S/C22H22F5N3O3/c23-17-18(24)20(26)22(21(27)19(17)25)33-13-16(32)30-8-4-7-29(9-10-30)12-15(31)28-11-14-5-2-1-3-6-14/h1-3,5-6H,4,7-13H2,(H,28,31) |
| InChIKey | IYDZZMGGXNLUMK-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.43 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|