C19H24F3N3O2S — CID 3675449
4-(5,5-dimethyl-2-oxo-1,3-oxazinan-3-yl)-N-[2-(trifluoromethyl)phenyl]piperidine-1-carbothioamide (PubChem CID 3675449) has the molecular formula C19H24F3N3O2S and a molecular weight of 415.48 g/mol. Its IUPAC name is 4-(5,5-dimethyl-2-oxo-1,3-oxazinan-3-yl)-N-[2-(trifluoromethyl)phenyl]piperidine-1-carbothioamide.
| Compound Name | 4-(5,5-dimethyl-2-oxo-1,3-oxazinan-3-yl)-N-[2-(trifluoromethyl)phenyl]piperidine-1-carbothioamide |
|---|---|
| PubChem CID | 3675449 |
| Molecular Formula | C19H24F3N3O2S |
| Molecular Weight | 415.48 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | 4-(5,5-dimethyl-2-oxo-1,3-oxazinan-3-yl)-N-[2-(trifluoromethyl)phenyl]piperidine-1-carbothioamide |
| SMILES | CC1(C)COC(=O)N(C2CCN(C(=S)Nc3ccccc3C(F)(F)F)CC2)C1 |
| InChI | InChI=1S/C19H24F3N3O2S/c1-18(2)11-25(17(26)27-12-18)13-7-9-24(10-8-13)16(28)23-15-6-4-3-5-14(15)19(20,21)22/h3-6,13H,7-12H2,1-2H3,(H,23,28) |
| InChIKey | HHLQCDYLJDIDIC-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.48 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|