C17H18F3N5O — CID 121190728
3-(4-cyclopropyltriazol-1-yl)-N-[2-(trifluoromethyl)phenyl]pyrrolidine-1-carboxamide (PubChem CID 121190728) has the molecular formula C17H18F3N5O and a molecular weight of 365.36 g/mol. Its IUPAC name is 3-(4-cyclopropyltriazol-1-yl)-N-[2-(trifluoromethyl)phenyl]pyrrolidine-1-carboxamide.
| Compound Name | 3-(4-cyclopropyltriazol-1-yl)-N-[2-(trifluoromethyl)phenyl]pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 121190728 |
| Molecular Formula | C17H18F3N5O |
| Molecular Weight | 365.36 g/mol |
| Exact Mass | 365.15 |
| IUPAC Name | 3-(4-cyclopropyltriazol-1-yl)-N-[2-(trifluoromethyl)phenyl]pyrrolidine-1-carboxamide |
| SMILES | O=C(Nc1ccccc1C(F)(F)F)N1CCC(n2cc(C3CC3)nn2)C1 |
| InChI | InChI=1S/C17H18F3N5O/c18-17(19,20)13-3-1-2-4-14(13)21-16(26)24-8-7-12(9-24)25-10-15(22-23-25)11-5-6-11/h1-4,10-12H,5-9H2,(H,21,26) |
| InChIKey | LOCCRGAQNHYIQG-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.36 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |