C13H14F3N3OS — CID 134115904
4,4-dimethyl-2-sulfanylidene-N-[2-(trifluoromethyl)phenyl]imidazolidine-1-carboxamide (PubChem CID 134115904) has the molecular formula C13H14F3N3OS and a molecular weight of 317.34 g/mol. Its IUPAC name is 4,4-dimethyl-2-sulfanylidene-N-[2-(trifluoromethyl)phenyl]imidazolidine-1-carboxamide.
| Compound Name | 4,4-dimethyl-2-sulfanylidene-N-[2-(trifluoromethyl)phenyl]imidazolidine-1-carboxamide |
|---|---|
| PubChem CID | 134115904 |
| Molecular Formula | C13H14F3N3OS |
| Molecular Weight | 317.34 g/mol |
| Exact Mass | 317.08 |
| IUPAC Name | 4,4-dimethyl-2-sulfanylidene-N-[2-(trifluoromethyl)phenyl]imidazolidine-1-carboxamide |
| SMILES | CC1(C)CN(C(=O)Nc2ccccc2C(F)(F)F)C(=S)N1 |
| InChI | InChI=1S/C13H14F3N3OS/c1-12(2)7-19(11(21)18-12)10(20)17-9-6-4-3-5-8(9)13(14,15)16/h3-6H,7H2,1-2H3,(H,17,20)(H,18,21) |
| InChIKey | NXYWUOJNMHPXRB-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.34 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|