C20H18F3N3O — CID 42695045
5-methyl-N-[2-(trifluoromethyl)phenyl]-3,4-dihydro-1H-pyrido[4,3-b]indole-2-carboxamide (PubChem CID 42695045) has the molecular formula C20H18F3N3O and a molecular weight of 373.38 g/mol. Its IUPAC name is 5-methyl-N-[2-(trifluoromethyl)phenyl]-3,4-dihydro-1H-pyrido[4,3-b]indole-2-carboxamide.
| Compound Name | 5-methyl-N-[2-(trifluoromethyl)phenyl]-3,4-dihydro-1H-pyrido[4,3-b]indole-2-carboxamide |
|---|---|
| PubChem CID | 42695045 |
| Molecular Formula | C20H18F3N3O |
| Molecular Weight | 373.38 g/mol |
| Exact Mass | 373.14 |
| IUPAC Name | 5-methyl-N-[2-(trifluoromethyl)phenyl]-3,4-dihydro-1H-pyrido[4,3-b]indole-2-carboxamide |
| SMILES | Cn1c2c(c3ccccc31)CN(C(=O)Nc1ccccc1C(F)(F)F)CC2 |
| InChI | InChI=1S/C20H18F3N3O/c1-25-17-9-5-2-6-13(17)14-12-26(11-10-18(14)25)19(27)24-16-8-4-3-7-15(16)20(21,22)23/h2-9H,10-12H2,1H3,(H,24,27) |
| InChIKey | SYMLZRZEWUVJTD-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.38 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|