C19H16Cl2N2O — CID 113089087
(3,4-dichlorophenyl)-(5-methyl-3,4-dihydro-1H-pyrido[4,3-b]indol-2-yl)methanone (PubChem CID 113089087) has the molecular formula C19H16Cl2N2O and a molecular weight of 359.26 g/mol. Its IUPAC name is (3,4-dichlorophenyl)-(5-methyl-3,4-dihydro-1H-pyrido[4,3-b]indol-2-yl)methanone.
| Compound Name | (3,4-dichlorophenyl)-(5-methyl-3,4-dihydro-1H-pyrido[4,3-b]indol-2-yl)methanone |
|---|---|
| PubChem CID | 113089087 |
| Molecular Formula | C19H16Cl2N2O |
| Molecular Weight | 359.26 g/mol |
| Exact Mass | 358.06 |
| IUPAC Name | (3,4-dichlorophenyl)-(5-methyl-3,4-dihydro-1H-pyrido[4,3-b]indol-2-yl)methanone |
| SMILES | Cn1c2c(c3ccccc31)CN(C(=O)c1ccc(Cl)c(Cl)c1)CC2 |
| InChI | InChI=1S/C19H16Cl2N2O/c1-22-17-5-3-2-4-13(17)14-11-23(9-8-18(14)22)19(24)12-6-7-15(20)16(21)10-12/h2-7,10H,8-9,11H2,1H3 |
| InChIKey | FDWWOXOEUJCMBZ-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.26 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|