C21H18Cl2N4O4 — CID 23543816
4-[4-(3,4-dichlorobenzoyl)piperazin-1-yl]-1-methyl-3-nitroquinolin-2-one (PubChem CID 23543816) has the molecular formula C21H18Cl2N4O4 and a molecular weight of 461.31 g/mol. Its IUPAC name is 4-[4-(3,4-dichlorobenzoyl)piperazin-1-yl]-1-methyl-3-nitroquinolin-2-one.
| Compound Name | 4-[4-(3,4-dichlorobenzoyl)piperazin-1-yl]-1-methyl-3-nitroquinolin-2-one |
|---|---|
| PubChem CID | 23543816 |
| Molecular Formula | C21H18Cl2N4O4 |
| Molecular Weight | 461.31 g/mol |
| Exact Mass | 460.07 |
| IUPAC Name | 4-[4-(3,4-dichlorobenzoyl)piperazin-1-yl]-1-methyl-3-nitroquinolin-2-one |
| SMILES | Cn1c(=O)c([N+](=O)[O-])c(N2CCN(C(=O)c3ccc(Cl)c(Cl)c3)CC2)c2ccccc21 |
| InChI | InChI=1S/C21H18Cl2N4O4/c1-24-17-5-3-2-4-14(17)18(19(21(24)29)27(30)31)25-8-10-26(11-9-25)20(28)13-6-7-15(22)16(23)12-13/h2-7,12H,8-11H2,1H3 |
| InChIKey | VREGRXDEONBDPS-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 88.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.31 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|