C26H32FN5O4 — CID 161319134
1-[3-(dimethylamino)propyl]-4-[4-(4-fluorobenzoyl)piperazin-1-yl]-3-nitroquinolin-2-one;methane (PubChem CID 161319134) has the molecular formula C26H32FN5O4 and a molecular weight of 497.57 g/mol. Its IUPAC name is 1-[3-(dimethylamino)propyl]-4-[4-(4-fluorobenzoyl)piperazin-1-yl]-3-nitroquinolin-2-one;methane.
| Compound Name | 1-[3-(dimethylamino)propyl]-4-[4-(4-fluorobenzoyl)piperazin-1-yl]-3-nitroquinolin-2-one;methane |
|---|---|
| PubChem CID | 161319134 |
| Molecular Formula | C26H32FN5O4 |
| Molecular Weight | 497.57 g/mol |
| Exact Mass | 497.24 |
| IUPAC Name | 1-[3-(dimethylamino)propyl]-4-[4-(4-fluorobenzoyl)piperazin-1-yl]-3-nitroquinolin-2-one;methane |
| SMILES | C.CN(C)CCCn1c(=O)c([N+](=O)[O-])c(N2CCN(C(=O)c3ccc(F)cc3)CC2)c2ccccc21 |
| InChI | InChI=1S/C25H28FN5O4.CH4/c1-27(2)12-5-13-30-21-7-4-3-6-20(21)22(23(25(30)33)31(34)35)28-14-16-29(17-15-28)24(32)18-8-10-19(26)11-9-18;/h3-4,6-11H,5,12-17H2,1-2H3;1H4 |
| InChIKey | VJXCLOBXYTWFHJ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 91.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.57 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|