C26H27ClFN5O5 — CID 160666698
azane;chloromethane;1-[(4-fluorophenyl)methyl]-4-[4-(furan-2-carbonyl)piperazin-1-yl]-3-nitroquinolin-2-one (PubChem CID 160666698) has the molecular formula C26H27ClFN5O5 and a molecular weight of 543.98 g/mol. Its IUPAC name is azane;chloromethane;1-[(4-fluorophenyl)methyl]-4-[4-(furan-2-carbonyl)piperazin-1-yl]-3-nitroquinolin-2-one.
| Compound Name | azane;chloromethane;1-[(4-fluorophenyl)methyl]-4-[4-(furan-2-carbonyl)piperazin-1-yl]-3-nitroquinolin-2-one |
|---|---|
| PubChem CID | 160666698 |
| Molecular Formula | C26H27ClFN5O5 |
| Molecular Weight | 543.98 g/mol |
| Exact Mass | 543.17 |
| IUPAC Name | azane;chloromethane;1-[(4-fluorophenyl)methyl]-4-[4-(furan-2-carbonyl)piperazin-1-yl]-3-nitroquinolin-2-one |
| SMILES | CCl.N.O=C(c1ccco1)N1CCN(c2c([N+](=O)[O-])c(=O)n(Cc3ccc(F)cc3)c3ccccc23)CC1 |
| InChI | InChI=1S/C25H21FN4O5.CH3Cl.H3N/c26-18-9-7-17(8-10-18)16-29-20-5-2-1-4-19(20)22(23(25(29)32)30(33)34)27-11-13-28(14-12-27)24(31)21-6-3-15-35-21;1-2;/h1-10,15H,11-14,16H2;1H3;1H3 |
| InChIKey | MHDUNOPKOQTNLM-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 136.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.98 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|