C26H24N4O5 — CID 23543752
1-benzyl-4-[4-(furan-2-carbonyl)piperazin-1-yl]-6-methyl-3-nitroquinolin-2-one (PubChem CID 23543752) has the molecular formula C26H24N4O5 and a molecular weight of 472.50 g/mol. Its IUPAC name is 1-benzyl-4-[4-(furan-2-carbonyl)piperazin-1-yl]-6-methyl-3-nitroquinolin-2-one.
| Compound Name | 1-benzyl-4-[4-(furan-2-carbonyl)piperazin-1-yl]-6-methyl-3-nitroquinolin-2-one |
|---|---|
| PubChem CID | 23543752 |
| Molecular Formula | C26H24N4O5 |
| Molecular Weight | 472.50 g/mol |
| Exact Mass | 472.17 |
| IUPAC Name | 1-benzyl-4-[4-(furan-2-carbonyl)piperazin-1-yl]-6-methyl-3-nitroquinolin-2-one |
| SMILES | Cc1ccc2c(c1)c(N1CCN(C(=O)c3ccco3)CC1)c([N+](=O)[O-])c(=O)n2Cc1ccccc1 |
| InChI | InChI=1S/C26H24N4O5/c1-18-9-10-21-20(16-18)23(27-11-13-28(14-12-27)25(31)22-8-5-15-35-22)24(30(33)34)26(32)29(21)17-19-6-3-2-4-7-19/h2-10,15-16H,11-14,17H2,1H3 |
| InChIKey | YNJDWXDAPVWBQW-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 101.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.50 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|