C27H22Cl2N4O4 — CID 23543755
1-benzyl-6-chloro-4-[4-(4-chlorobenzoyl)piperazin-1-yl]-3-nitroquinolin-2-one (PubChem CID 23543755) has the molecular formula C27H22Cl2N4O4 and a molecular weight of 537.40 g/mol. Its IUPAC name is 1-benzyl-6-chloro-4-[4-(4-chlorobenzoyl)piperazin-1-yl]-3-nitroquinolin-2-one.
| Compound Name | 1-benzyl-6-chloro-4-[4-(4-chlorobenzoyl)piperazin-1-yl]-3-nitroquinolin-2-one |
|---|---|
| PubChem CID | 23543755 |
| Molecular Formula | C27H22Cl2N4O4 |
| Molecular Weight | 537.40 g/mol |
| Exact Mass | 536.10 |
| IUPAC Name | 1-benzyl-6-chloro-4-[4-(4-chlorobenzoyl)piperazin-1-yl]-3-nitroquinolin-2-one |
| SMILES | O=C(c1ccc(Cl)cc1)N1CCN(c2c([N+](=O)[O-])c(=O)n(Cc3ccccc3)c3ccc(Cl)cc23)CC1 |
| InChI | InChI=1S/C27H22Cl2N4O4/c28-20-8-6-19(7-9-20)26(34)31-14-12-30(13-15-31)24-22-16-21(29)10-11-23(22)32(27(35)25(24)33(36)37)17-18-4-2-1-3-5-18/h1-11,16H,12-15,17H2 |
| InChIKey | QVTYDGVXWDBGFC-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 88.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.40 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|