C22H25Cl2N5O4 — CID 161362811
azane;4-[4-(4-chlorobenzoyl)piperazin-1-yl]-1-methyl-3-nitroquinolin-2-one;chloromethane (PubChem CID 161362811) has the molecular formula C22H25Cl2N5O4 and a molecular weight of 494.38 g/mol. Its IUPAC name is azane;4-[4-(4-chlorobenzoyl)piperazin-1-yl]-1-methyl-3-nitroquinolin-2-one;chloromethane.
| Compound Name | azane;4-[4-(4-chlorobenzoyl)piperazin-1-yl]-1-methyl-3-nitroquinolin-2-one;chloromethane |
|---|---|
| PubChem CID | 161362811 |
| Molecular Formula | C22H25Cl2N5O4 |
| Molecular Weight | 494.38 g/mol |
| Exact Mass | 493.13 |
| IUPAC Name | azane;4-[4-(4-chlorobenzoyl)piperazin-1-yl]-1-methyl-3-nitroquinolin-2-one;chloromethane |
| SMILES | CCl.Cn1c(=O)c([N+](=O)[O-])c(N2CCN(C(=O)c3ccc(Cl)cc3)CC2)c2ccccc21.N |
| InChI | InChI=1S/C21H19ClN4O4.CH3Cl.H3N/c1-23-17-5-3-2-4-16(17)18(19(21(23)28)26(29)30)24-10-12-25(13-11-24)20(27)14-6-8-15(22)9-7-14;1-2;/h2-9H,10-13H2,1H3;1H3;1H3 |
| InChIKey | SGCWMACOJLZXKD-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 123.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.38 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|