C20H19N5O4 — CID 23543785
1-methyl-3-nitro-4-[4-(pyridine-3-carbonyl)piperazin-1-yl]quinolin-2-one (PubChem CID 23543785) has the molecular formula C20H19N5O4 and a molecular weight of 393.40 g/mol. Its IUPAC name is 1-methyl-3-nitro-4-[4-(pyridine-3-carbonyl)piperazin-1-yl]quinolin-2-one.
| Compound Name | 1-methyl-3-nitro-4-[4-(pyridine-3-carbonyl)piperazin-1-yl]quinolin-2-one |
|---|---|
| PubChem CID | 23543785 |
| Molecular Formula | C20H19N5O4 |
| Molecular Weight | 393.40 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | 1-methyl-3-nitro-4-[4-(pyridine-3-carbonyl)piperazin-1-yl]quinolin-2-one |
| SMILES | Cn1c(=O)c([N+](=O)[O-])c(N2CCN(C(=O)c3cccnc3)CC2)c2ccccc21 |
| InChI | InChI=1S/C20H19N5O4/c1-22-16-7-3-2-6-15(16)17(18(20(22)27)25(28)29)23-9-11-24(12-10-23)19(26)14-5-4-8-21-13-14/h2-8,13H,9-12H2,1H3 |
| InChIKey | KHNQLKSIFUTPCS-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 101.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.40 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|