C21H22N4O4S — CID 23543771
1-methyl-3-methylsulfonyl-4-[4-(pyridine-4-carbonyl)piperazin-1-yl]quinolin-2-one (PubChem CID 23543771) has the molecular formula C21H22N4O4S and a molecular weight of 426.50 g/mol. Its IUPAC name is 1-methyl-3-methylsulfonyl-4-[4-(pyridine-4-carbonyl)piperazin-1-yl]quinolin-2-one.
| Compound Name | 1-methyl-3-methylsulfonyl-4-[4-(pyridine-4-carbonyl)piperazin-1-yl]quinolin-2-one |
|---|---|
| PubChem CID | 23543771 |
| Molecular Formula | C21H22N4O4S |
| Molecular Weight | 426.50 g/mol |
| Exact Mass | 426.14 |
| IUPAC Name | 1-methyl-3-methylsulfonyl-4-[4-(pyridine-4-carbonyl)piperazin-1-yl]quinolin-2-one |
| SMILES | Cn1c(=O)c(S(C)(=O)=O)c(N2CCN(C(=O)c3ccncc3)CC2)c2ccccc21 |
| InChI | InChI=1S/C21H22N4O4S/c1-23-17-6-4-3-5-16(17)18(19(21(23)27)30(2,28)29)24-11-13-25(14-12-24)20(26)15-7-9-22-10-8-15/h3-10H,11-14H2,1-2H3 |
| InChIKey | QUZLBDMCBWSATP-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 92.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.50 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |