C20H19F3N4O5 — CID 162598894
3-(dihydroxyamino)-4-[4-(furan-2-carbonyl)piperazin-1-yl]-1-(2,2,2-trifluoroethyl)quinolin-2-one (PubChem CID 162598894) has the molecular formula C20H19F3N4O5 and a molecular weight of 452.39 g/mol. Its IUPAC name is 3-(dihydroxyamino)-4-[4-(furan-2-carbonyl)piperazin-1-yl]-1-(2,2,2-trifluoroethyl)quinolin-2-one.
| Compound Name | 3-(dihydroxyamino)-4-[4-(furan-2-carbonyl)piperazin-1-yl]-1-(2,2,2-trifluoroethyl)quinolin-2-one |
|---|---|
| PubChem CID | 162598894 |
| Molecular Formula | C20H19F3N4O5 |
| Molecular Weight | 452.39 g/mol |
| Exact Mass | 452.13 |
| IUPAC Name | 3-(dihydroxyamino)-4-[4-(furan-2-carbonyl)piperazin-1-yl]-1-(2,2,2-trifluoroethyl)quinolin-2-one |
| SMILES | O=C(c1ccco1)N1CCN(c2c(N(O)O)c(=O)n(CC(F)(F)F)c3ccccc23)CC1 |
| InChI | InChI=1S/C20H19F3N4O5/c21-20(22,23)12-26-14-5-2-1-4-13(14)16(17(19(26)29)27(30)31)24-7-9-25(10-8-24)18(28)15-6-3-11-32-15/h1-6,11,30-31H,7-10,12H2 |
| InChIKey | UJTLBSACKGYIGV-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 102.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.39 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|