C24H25NO7 — CID 90662562
1-O-benzyl 5-O-methyl 2-acetyl-3-[(4S)-2-oxo-4-phenyl-1,3-oxazolidin-3-yl]pentanedioate (PubChem CID 90662562) has the molecular formula C24H25NO7 and a molecular weight of 439.46 g/mol. Its IUPAC name is 1-O-benzyl 5-O-methyl 2-acetyl-3-[(4S)-2-oxo-4-phenyl-1,3-oxazolidin-3-yl]pentanedioate.
| Compound Name | 1-O-benzyl 5-O-methyl 2-acetyl-3-[(4S)-2-oxo-4-phenyl-1,3-oxazolidin-3-yl]pentanedioate |
|---|---|
| PubChem CID | 90662562 |
| Molecular Formula | C24H25NO7 |
| Molecular Weight | 439.46 g/mol |
| Exact Mass | 439.16 |
| IUPAC Name | 1-O-benzyl 5-O-methyl 2-acetyl-3-[(4S)-2-oxo-4-phenyl-1,3-oxazolidin-3-yl]pentanedioate |
| SMILES | COC(=O)CC(C(C(C)=O)C(=O)OCc1ccccc1)N1C(=O)OC[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C24H25NO7/c1-16(26)22(23(28)31-14-17-9-5-3-6-10-17)19(13-21(27)30-2)25-20(15-32-24(25)29)18-11-7-4-8-12-18/h3-12,19-20,22H,13-15H2,1-2H3/t19?,20-,22?/m1/s1 |
| InChIKey | GFQPDPJYPJHRKN-SNCIUUNGSA-N |
| XLogP | 3.06 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.46 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|