C45H57NO8Si — CID 102217320
(4S)-4-benzyl-3-[(2S,3S,4R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-2,4,6-tris(phenylmethoxy)hexanoyl]-5,5-dimethyl-1,3-oxazolidin-2-one (PubChem CID 102217320) has the molecular formula C45H57NO8Si and a molecular weight of 768.04 g/mol. Its IUPAC name is (4S)-4-benzyl-3-[(2S,3S,4R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-2,4,6-tris(phenylmethoxy)hexanoyl]-5,5-dimethyl-1,3-oxazolidin-2-one.
| Compound Name | (4S)-4-benzyl-3-[(2S,3S,4R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-2,4,6-tris(phenylmethoxy)hexanoyl]-5,5-dimethyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 102217320 |
| Molecular Formula | C45H57NO8Si |
| Molecular Weight | 768.04 g/mol |
| Exact Mass | 767.39 |
| IUPAC Name | (4S)-4-benzyl-3-[(2S,3S,4R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-2,4,6-tris(phenylmethoxy)hexanoyl]-5,5-dimethyl-1,3-oxazolidin-2-one |
| SMILES | CC1(C)OC(=O)N(C(=O)[C@@H](OCc2ccccc2)[C@@H](O)[C@@H](OCc2ccccc2)[C@@H](COCc2ccccc2)O[Si](C)(C)C(C)(C)C)[C@H]1Cc1ccccc1 |
| InChI | InChI=1S/C45H57NO8Si/c1-44(2,3)55(6,7)54-37(32-50-29-34-22-14-9-15-23-34)40(51-30-35-24-16-10-17-25-35)39(47)41(52-31-36-26-18-11-19-27-36)42(48)46-38(45(4,5)53-43(46)49)28-33-20-12-8-13-21-33/h8-27,37-41,47H,28-32H2,1-7H3/t37-,38+,39+,40+,41+/m1/s1 |
| InChIKey | MBMFOIOYUWMLPS-ORLFITTNSA-N |
| XLogP | 8.49 |
| TPSA | 103.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 768.04 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|