C26H35N2O4+ — CID 22894176
2-(4-benzyl-5,5-dimethyl-2-oxo-1,3-oxazolidine-3-carbonyl)hexyl-phenylmethoxyazanium (PubChem CID 22894176) has the molecular formula C26H35N2O4+ and a molecular weight of 439.58 g/mol. Its IUPAC name is 2-(4-benzyl-5,5-dimethyl-2-oxo-1,3-oxazolidine-3-carbonyl)hexyl-phenylmethoxyazanium.
| Compound Name | 2-(4-benzyl-5,5-dimethyl-2-oxo-1,3-oxazolidine-3-carbonyl)hexyl-phenylmethoxyazanium |
|---|---|
| PubChem CID | 22894176 |
| Molecular Formula | C26H35N2O4+ |
| Molecular Weight | 439.58 g/mol |
| Exact Mass | 439.26 |
| IUPAC Name | 2-(4-benzyl-5,5-dimethyl-2-oxo-1,3-oxazolidine-3-carbonyl)hexyl-phenylmethoxyazanium |
| SMILES | CCCCC(C[NH2+]OCc1ccccc1)C(=O)N1C(=O)OC(C)(C)C1Cc1ccccc1 |
| InChI | InChI=1S/C26H34N2O4/c1-4-5-16-22(18-27-31-19-21-14-10-7-11-15-21)24(29)28-23(26(2,3)32-25(28)30)17-20-12-8-6-9-13-20/h6-15,22-23,27H,4-5,16-19H2,1-3H3/p+1 |
| InChIKey | OMDYRGGDKHFEGQ-UHFFFAOYSA-O |
| XLogP | 3.86 |
| TPSA | 72.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.58 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|