C44H44N4O12 — CID 139117529
benzyl N-[(1R,2R)-3-oxo-2-(2-oxo-1,3-oxazolidine-3-carbonyl)-1-phenylbutyl]carbamate (PubChem CID 139117529) has the molecular formula C44H44N4O12 and a molecular weight of 820.85 g/mol. Its IUPAC name is benzyl N-[(1R,2R)-3-oxo-2-(2-oxo-1,3-oxazolidine-3-carbonyl)-1-phenylbutyl]carbamate.
| Compound Name | benzyl N-[(1R,2R)-3-oxo-2-(2-oxo-1,3-oxazolidine-3-carbonyl)-1-phenylbutyl]carbamate |
|---|---|
| PubChem CID | 139117529 |
| Molecular Formula | C44H44N4O12 |
| Molecular Weight | 820.85 g/mol |
| Exact Mass | 820.30 |
| IUPAC Name | benzyl N-[(1R,2R)-3-oxo-2-(2-oxo-1,3-oxazolidine-3-carbonyl)-1-phenylbutyl]carbamate |
| SMILES | CC(=O)[C@H](C(=O)N1CCOC1=O)[C@@H](NC(=O)OCc1ccccc1)c1ccccc1.CC(=O)[C@H](C(=O)N1CCOC1=O)[C@@H](NC(=O)OCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/2C22H22N2O6/c2*1-15(25)18(20(26)24-12-13-29-22(24)28)19(17-10-6-3-7-11-17)23-21(27)30-14-16-8-4-2-5-9-16/h2*2-11,18-19H,12-14H2,1H3,(H,23,27)/t2*18-,19-/m00/s1 |
| InChIKey | LBWKMQSGJOLZHD-BYPDJTGLSA-N |
| XLogP | 5.68 |
| TPSA | 204.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 820.85 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|