C29H30N2O6 — CID 142657362
[1-[3-[(2-oxo-1,3-oxazolidin-3-yl)methyl]phenyl]-3-phenyl-2-(phenylmethoxycarbonylamino)propyl] acetate (PubChem CID 142657362) has the molecular formula C29H30N2O6 and a molecular weight of 502.57 g/mol. Its IUPAC name is [1-[3-[(2-oxo-1,3-oxazolidin-3-yl)methyl]phenyl]-3-phenyl-2-(phenylmethoxycarbonylamino)propyl] acetate.
| Compound Name | [1-[3-[(2-oxo-1,3-oxazolidin-3-yl)methyl]phenyl]-3-phenyl-2-(phenylmethoxycarbonylamino)propyl] acetate |
|---|---|
| PubChem CID | 142657362 |
| Molecular Formula | C29H30N2O6 |
| Molecular Weight | 502.57 g/mol |
| Exact Mass | 502.21 |
| IUPAC Name | [1-[3-[(2-oxo-1,3-oxazolidin-3-yl)methyl]phenyl]-3-phenyl-2-(phenylmethoxycarbonylamino)propyl] acetate |
| SMILES | CC(=O)OC(c1cccc(CN2CCOC2=O)c1)C(Cc1ccccc1)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C29H30N2O6/c1-21(32)37-27(25-14-8-13-24(17-25)19-31-15-16-35-29(31)34)26(18-22-9-4-2-5-10-22)30-28(33)36-20-23-11-6-3-7-12-23/h2-14,17,26-27H,15-16,18-20H2,1H3,(H,30,33) |
| InChIKey | TWUWMUZWBDDKGC-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.57 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|